C28H24O18 — CID 162963417
(7,8,9,12,13,14,23,24-octahydroxy-4,17-dioxo-2,18,21-trioxatetracyclo[18.3.1.05,10.011,16]tetracosa-5,7,9,11,13,15-hexaen-22-yl) 3,4,5-trihydroxybenzoate (PubChem CID 162963417) has the molecular formula C28H24O18 and a molecular weight of 648.48 g/mol. Its IUPAC name is (7,8,9,12,13,14,23,24-octahydroxy-4,17-dioxo-2,18,21-trioxatetracyclo[18.3.1.05,10.011,16]tetracosa-5,7,9,11,13,15-hexaen-22-yl) 3,4,5-trihydroxybenzoate.
| Compound Name | (7,8,9,12,13,14,23,24-octahydroxy-4,17-dioxo-2,18,21-trioxatetracyclo[18.3.1.05,10.011,16]tetracosa-5,7,9,11,13,15-hexaen-22-yl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 162963417 |
| Molecular Formula | C28H24O18 |
| Molecular Weight | 648.48 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | (7,8,9,12,13,14,23,24-octahydroxy-4,17-dioxo-2,18,21-trioxatetracyclo[18.3.1.05,10.011,16]tetracosa-5,7,9,11,13,15-hexaen-22-yl) 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC1OC2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)COC(C2O)C1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C28H24O18/c29-10-1-7(2-11(30)18(10)34)26(41)46-28-24(40)25-21(37)15(45-28)6-44-27(42)9-4-13(32)20(36)23(39)17(9)16-8(14(33)5-43-25)3-12(31)19(35)22(16)38/h1-4,15,21,24-25,28-32,34-40H,5-6H2 |
| InChIKey | UNXPYDBKJSDIIX-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 310.66 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.48 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|