C34H28O22 — CID 166671177
[3,4,5,11,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(19),2,4,6,20-pentaen-12-yl] 3,4,5-trihydroxybenzoate (PubChem CID 166671177) has the molecular formula C34H28O22 and a molecular weight of 788.58 g/mol. Its IUPAC name is [3,4,5,11,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(19),2,4,6,20-pentaen-12-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3,4,5,11,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(19),2,4,6,20-pentaen-12-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 166671177 |
| Molecular Formula | C34H28O22 |
| Molecular Weight | 788.58 g/mol |
| Exact Mass | 788.11 |
| IUPAC Name | [3,4,5,11,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(19),2,4,6,20-pentaen-12-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C1OCC2OC(OC(=O)c3cc(O)c(O)c(O)c3)C(OC(=O)c3cc(O)c(O)c(O)c3)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2C2=C1C=C(O)C(O)C2O |
| InChI | InChI=1S/C34H28O22/c35-12-1-8(2-13(36)21(12)41)30(48)55-29-27(47)28-18(53-34(29)56-31(49)9-3-14(37)22(42)15(38)4-9)7-52-32(50)10-5-16(39)23(43)25(45)19(10)20-11(33(51)54-28)6-17(40)24(44)26(20)46/h1-6,18,23,25,27-29,34-47H,7H2 |
| InChIKey | RCCQFJUKYOBIOJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 377.42 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.58 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|