C32H54O — CID 162965832
(3S,4aR,6aR,6bR,8aR,12aR,14aR,14bS)-3-methoxy-4,4,6a,6b,8a,11,11,14a,14b-nonamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene (PubChem CID 162965832) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is (3S,4aR,6aR,6bR,8aR,12aR,14aR,14bS)-3-methoxy-4,4,6a,6b,8a,11,11,14a,14b-nonamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene.
| Compound Name | (3S,4aR,6aR,6bR,8aR,12aR,14aR,14bS)-3-methoxy-4,4,6a,6b,8a,11,11,14a,14b-nonamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene |
|---|---|
| PubChem CID | 162965832 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | (3S,4aR,6aR,6bR,8aR,12aR,14aR,14bS)-3-methoxy-4,4,6a,6b,8a,11,11,14a,14b-nonamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene |
| SMILES | CO[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@]2(C)CC=C2[C@@H]4CC(C)(C)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C32H54O/c1-26(2)17-18-28(5)19-20-29(6)22(23(28)21-26)11-15-32(9)30(7)14-13-25(33-10)27(3,4)24(30)12-16-31(29,32)8/h11,23-25H,12-21H2,1-10H3/t23-,24-,25-,28+,29+,30-,31-,32+/m0/s1 |
| InChIKey | XCQNHFZXGRQNOG-UQHXOIPPSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|