C36H60O2 — CID 162891380
[(3S,4aS,6aR,6bS,8aR,12aR,14aS,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] hexanoate (PubChem CID 162891380) has the molecular formula C36H60O2 and a molecular weight of 524.87 g/mol. Its IUPAC name is [(3S,4aS,6aR,6bS,8aR,12aR,14aS,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] hexanoate.
| Compound Name | [(3S,4aS,6aR,6bS,8aR,12aR,14aS,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] hexanoate |
|---|---|
| PubChem CID | 162891380 |
| Molecular Formula | C36H60O2 |
| Molecular Weight | 524.87 g/mol |
| Exact Mass | 524.46 |
| IUPAC Name | [(3S,4aS,6aR,6bS,8aR,12aR,14aS,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@]3(C)[C@H]2CC=C2[C@@H]4CC(C)(C)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C36H60O2/c1-10-11-12-13-30(37)38-29-17-18-34(7)27(32(29,4)5)16-19-36(9)28(34)15-14-25-26-24-31(2,3)20-21-33(26,6)22-23-35(25,36)8/h14,26-29H,10-13,15-24H2,1-9H3/t26-,27+,28-,29-,33+,34-,35+,36+/m0/s1 |
| InChIKey | PDNXQGQWSKOSGH-ZKFURGJLSA-N |
| XLogP | 10.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.87 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|