C38H64O2 — CID 74369062
(4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl) octanoate (PubChem CID 74369062) has the molecular formula C38H64O2 and a molecular weight of 552.93 g/mol. Its IUPAC name is (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl) octanoate.
| Compound Name | (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl) octanoate |
|---|---|
| PubChem CID | 74369062 |
| Molecular Formula | C38H64O2 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.49 |
| IUPAC Name | (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4C(C)C(C)CCC4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C38H64O2/c1-10-11-12-13-14-15-32(39)40-31-20-22-36(7)29(34(31,4)5)19-23-38(9)30(36)17-16-28-33-27(3)26(2)18-21-35(33,6)24-25-37(28,38)8/h16,26-27,29-31,33H,10-15,17-25H2,1-9H3 |
| InChIKey | UZLQVROEJVLMNP-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|