C35H56O3 — CID 86288838
[(3S,6aR,6bS,8aS,11R,12S,14bR)-8a-acetyl-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] butanoate (PubChem CID 86288838) has the molecular formula C35H56O3 and a molecular weight of 524.83 g/mol. Its IUPAC name is [(3S,6aR,6bS,8aS,11R,12S,14bR)-8a-acetyl-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] butanoate.
| Compound Name | [(3S,6aR,6bS,8aS,11R,12S,14bR)-8a-acetyl-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] butanoate |
|---|---|
| PubChem CID | 86288838 |
| Molecular Formula | C35H56O3 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.42 |
| IUPAC Name | [(3S,6aR,6bS,8aS,11R,12S,14bR)-8a-acetyl-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CC=C2C4[C@@H](C)[C@H](C)CC[C@]4(C(C)=O)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C35H56O3/c1-10-11-29(37)38-28-16-17-32(7)26(31(28,5)6)15-18-34(9)27(32)13-12-25-30-23(3)22(2)14-19-35(30,24(4)36)21-20-33(25,34)8/h12,22-23,26-28,30H,10-11,13-21H2,1-9H3/t22-,23+,26?,27?,28+,30?,32+,33-,34-,35-/m1/s1 |
| InChIKey | UUMGLJTZKRFTRN-HNLYSRMUSA-N |
| XLogP | 8.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|