C34H56N2O3 — CID 132527538
[(4aR,6aR,6bS,8aS,11S,12R,12aR,14aR,14bR)-8a-(2-aminoethylcarbamoyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate (PubChem CID 132527538) has the molecular formula C34H56N2O3 and a molecular weight of 540.83 g/mol. Its IUPAC name is [(4aR,6aR,6bS,8aS,11S,12R,12aR,14aR,14bR)-8a-(2-aminoethylcarbamoyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(4aR,6aR,6bS,8aS,11S,12R,12aR,14aR,14bR)-8a-(2-aminoethylcarbamoyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 132527538 |
| Molecular Formula | C34H56N2O3 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.43 |
| IUPAC Name | [(4aR,6aR,6bS,8aS,11S,12R,12aR,14aR,14bR)-8a-(2-aminoethylcarbamoyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@]2(C)[C@H]3CC=C4[C@H]5[C@H](C)[C@@H](C)CC[C@]5(C(=O)NCCN)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C34H56N2O3/c1-21-11-16-34(29(38)36-20-19-35)18-17-32(7)24(28(34)22(21)2)9-10-26-31(6)14-13-27(39-23(3)37)30(4,5)25(31)12-15-33(26,32)8/h9,21-22,25-28H,10-20,35H2,1-8H3,(H,36,38)/t21-,22+,25-,26+,27?,28+,31-,32+,33+,34-/m0/s1 |
| InChIKey | HGLDZVONEAYGCZ-LDOJPIMLSA-N |
| XLogP | 6.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|