C36H59NO5 — CID 53330093
[(3S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[bis(2-hydroxyethyl)carbamoyl]-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate (PubChem CID 53330093) has the molecular formula C36H59NO5 and a molecular weight of 585.87 g/mol. Its IUPAC name is [(3S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[bis(2-hydroxyethyl)carbamoyl]-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[bis(2-hydroxyethyl)carbamoyl]-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 53330093 |
| Molecular Formula | C36H59NO5 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.44 |
| IUPAC Name | [(3S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[bis(2-hydroxyethyl)carbamoyl]-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C(=O)N(CCO)CCO)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C36H59NO5/c1-23-11-16-36(31(41)37(19-21-38)20-22-39)18-17-34(7)26(30(36)24(23)2)9-10-28-33(6)14-13-29(42-25(3)40)32(4,5)27(33)12-15-35(28,34)8/h9,23-24,27-30,38-39H,10-22H2,1-8H3/t23-,24+,27+,28-,29+,30+,33+,34-,35-,36+/m1/s1 |
| InChIKey | RBNMGIFZWYKALF-PNOHBZKLSA-N |
| XLogP | 6.39 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|