C37H50O10 — CID 162965886
[6,7,8,9-tetrahydroxy-8-(hydroxymethyl)-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-5-yl] deca-2,4-dienoate (PubChem CID 162965886) has the molecular formula C37H50O10 and a molecular weight of 654.80 g/mol. Its IUPAC name is [6,7,8,9-tetrahydroxy-8-(hydroxymethyl)-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-5-yl] deca-2,4-dienoate.
| Compound Name | [6,7,8,9-tetrahydroxy-8-(hydroxymethyl)-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-5-yl] deca-2,4-dienoate |
|---|---|
| PubChem CID | 162965886 |
| Molecular Formula | C37H50O10 |
| Molecular Weight | 654.80 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | [6,7,8,9-tetrahydroxy-8-(hydroxymethyl)-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-5-yl] deca-2,4-dienoate |
| SMILES | C=C(C)C12CC(C)C34OC(c5ccccc5)(OC1C3C(O)C(O)(CO)C(O)C1(O)C(OC(=O)C=CC=CCCCCC)C(C)CC14)O2 |
| InChI | InChI=1S/C37H50O10/c1-6-7-8-9-10-11-15-18-27(39)44-30-23(4)19-26-35(30,43)32(41)33(42,21-38)29(40)28-31-34(22(2)3)20-24(5)36(26,28)47-37(45-31,46-34)25-16-13-12-14-17-25/h10-18,23-24,26,28-32,38,40-43H,2,6-9,19-21H2,1,3-5H3 |
| InChIKey | JUJGXBCUCIDDJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|