C34H40O10 — CID 163047630
(5,6,7,8,9-pentahydroxy-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-8-yl)methyl benzoate (PubChem CID 163047630) has the molecular formula C34H40O10 and a molecular weight of 608.68 g/mol. Its IUPAC name is (5,6,7,8,9-pentahydroxy-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-8-yl)methyl benzoate.
| Compound Name | (5,6,7,8,9-pentahydroxy-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-8-yl)methyl benzoate |
|---|---|
| PubChem CID | 163047630 |
| Molecular Formula | C34H40O10 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | (5,6,7,8,9-pentahydroxy-4,17-dimethyl-13-phenyl-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadecan-8-yl)methyl benzoate |
| SMILES | C=C(C)C12CC(C)C34OC(c5ccccc5)(OC1C3C(O)C(O)(COC(=O)c1ccccc1)C(O)C1(O)C(O)C(C)CC14)O2 |
| InChI | InChI=1S/C34H40O10/c1-18(2)31-16-20(4)33-23-15-19(3)25(35)32(23,40)29(38)30(39,17-41-28(37)21-11-7-5-8-12-21)26(36)24(33)27(31)42-34(43-31,44-33)22-13-9-6-10-14-22/h5-14,19-20,23-27,29,35-36,38-40H,1,15-17H2,2-4H3 |
| InChIKey | GJDBMFKJSZJSLK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|