C21H20O16 — CID 162966997
2-[(5R,6R,8R,9R,12R,13S,14R,22S)-6,14,18,19,22-pentahydroxy-8-(hydroxymethyl)-2,3,11,15-tetraoxo-4,7,10,16-tetraoxatetracyclo[11.7.1.15,9.017,21]docosa-1(20),17(21),18-trien-12-yl]acetic acid (PubChem CID 162966997) has the molecular formula C21H20O16 and a molecular weight of 528.38 g/mol. Its IUPAC name is 2-[(5R,6R,8R,9R,12R,13S,14R,22S)-6,14,18,19,22-pentahydroxy-8-(hydroxymethyl)-2,3,11,15-tetraoxo-4,7,10,16-tetraoxatetracyclo[11.7.1.15,9.017,21]docosa-1(20),17(21),18-trien-12-yl]acetic acid.
| Compound Name | 2-[(5R,6R,8R,9R,12R,13S,14R,22S)-6,14,18,19,22-pentahydroxy-8-(hydroxymethyl)-2,3,11,15-tetraoxo-4,7,10,16-tetraoxatetracyclo[11.7.1.15,9.017,21]docosa-1(20),17(21),18-trien-12-yl]acetic acid |
|---|---|
| PubChem CID | 162966997 |
| Molecular Formula | C21H20O16 |
| Molecular Weight | 528.38 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 2-[(5R,6R,8R,9R,12R,13S,14R,22S)-6,14,18,19,22-pentahydroxy-8-(hydroxymethyl)-2,3,11,15-tetraoxo-4,7,10,16-tetraoxatetracyclo[11.7.1.15,9.017,21]docosa-1(20),17(21),18-trien-12-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1C(=O)O[C@@H]2[C@H](O)[C@@H](OC(=O)C(=O)c3cc(O)c(O)c4c3[C@H]1[C@@H](O)C(=O)O4)[C@H](O)O[C@@H]2CO |
| InChI | InChI=1S/C21H20O16/c22-3-7-15-14(29)17(21(33)34-7)37-19(31)11(26)4-1-6(23)12(27)16-10(4)9(13(28)20(32)36-16)5(2-8(24)25)18(30)35-15/h1,5,7,9,13-15,17,21-23,27-29,33H,2-3H2,(H,24,25)/t5-,7-,9+,13-,14+,15+,17-,21-/m1/s1 |
| InChIKey | AZTPRINHIPZIJE-WKCBXJPDSA-N |
| XLogP | -3.36 |
| TPSA | 263.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.38 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|