C21H32N2O2 — CID 162968981
N-(4-hydroxy-4-methyl-2-phenyl-1-propylpiperidin-3-yl)cyclopentanecarboxamide (PubChem CID 162968981) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-(4-hydroxy-4-methyl-2-phenyl-1-propylpiperidin-3-yl)cyclopentanecarboxamide.
| Compound Name | N-(4-hydroxy-4-methyl-2-phenyl-1-propylpiperidin-3-yl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 162968981 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | N-(4-hydroxy-4-methyl-2-phenyl-1-propylpiperidin-3-yl)cyclopentanecarboxamide |
| SMILES | CCCN1CCC(C)(O)C(NC(=O)C2CCCC2)C1c1ccccc1 |
| InChI | InChI=1S/C21H32N2O2/c1-3-14-23-15-13-21(2,25)19(18(23)16-9-5-4-6-10-16)22-20(24)17-11-7-8-12-17/h4-6,9-10,17-19,25H,3,7-8,11-15H2,1-2H3,(H,22,24) |
| InChIKey | DWBYMZQIBAZITB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |