C26H32N2O4 — CID 162790486
N-[4-hydroxy-4-methyl-1-(2-phenoxyacetyl)-2-phenylpiperidin-3-yl]cyclopentanecarboxamide (PubChem CID 162790486) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[4-hydroxy-4-methyl-1-(2-phenoxyacetyl)-2-phenylpiperidin-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[4-hydroxy-4-methyl-1-(2-phenoxyacetyl)-2-phenylpiperidin-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 162790486 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[4-hydroxy-4-methyl-1-(2-phenoxyacetyl)-2-phenylpiperidin-3-yl]cyclopentanecarboxamide |
| SMILES | CC1(O)CCN(C(=O)COc2ccccc2)C(c2ccccc2)C1NC(=O)C1CCCC1 |
| InChI | InChI=1S/C26H32N2O4/c1-26(31)16-17-28(22(29)18-32-21-14-6-3-7-15-21)23(19-10-4-2-5-11-19)24(26)27-25(30)20-12-8-9-13-20/h2-7,10-11,14-15,20,23-24,31H,8-9,12-13,16-18H2,1H3,(H,27,30) |
| InChIKey | QEQHTRNQKSXOMI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |