C32H30O15 — CID 162969272
3-oxo-3-[[3,4,6-trihydroxy-5-[[16-[(3-hydroxyphenyl)methyl]-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-yl]peroxy]oxan-2-yl]methoxy]propanoic acid (PubChem CID 162969272) has the molecular formula C32H30O15 and a molecular weight of 654.58 g/mol. Its IUPAC name is 3-oxo-3-[[3,4,6-trihydroxy-5-[[16-[(3-hydroxyphenyl)methyl]-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-yl]peroxy]oxan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-oxo-3-[[3,4,6-trihydroxy-5-[[16-[(3-hydroxyphenyl)methyl]-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-yl]peroxy]oxan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 162969272 |
| Molecular Formula | C32H30O15 |
| Molecular Weight | 654.58 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | 3-oxo-3-[[3,4,6-trihydroxy-5-[[16-[(3-hydroxyphenyl)methyl]-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-yl]peroxy]oxan-2-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CC(=O)OCC1OC(O)C(OOc2cc3c(cc2Cc2cccc(O)c2)OCC2c4cc5c(cc4OC32)OCO5)C(O)C1O |
| InChI | InChI=1S/C32H30O15/c33-16-3-1-2-14(5-16)4-15-6-21-18(30-19(11-40-21)17-7-23-24(43-13-42-23)9-22(17)44-30)8-20(15)46-47-31-29(38)28(37)25(45-32(31)39)12-41-27(36)10-26(34)35/h1-3,5-9,19,25,28-33,37-39H,4,10-13H2,(H,34,35) |
| InChIKey | DTNYZTURCKWHEN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 209.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|