C28H42O8 — CID 162969960
[(1R,2R,5S,7R,9S,11S,12R,15S,16S,17R)-15-acetyl-5,11,12,15-tetrahydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-17-yl] 3,4-dimethylpent-2-enoate (PubChem CID 162969960) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is [(1R,2R,5S,7R,9S,11S,12R,15S,16S,17R)-15-acetyl-5,11,12,15-tetrahydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-17-yl] 3,4-dimethylpent-2-enoate.
| Compound Name | [(1R,2R,5S,7R,9S,11S,12R,15S,16S,17R)-15-acetyl-5,11,12,15-tetrahydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-17-yl] 3,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 162969960 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [(1R,2R,5S,7R,9S,11S,12R,15S,16S,17R)-15-acetyl-5,11,12,15-tetrahydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-17-yl] 3,4-dimethylpent-2-enoate |
| SMILES | CC(=O)[C@]1(O)CC[C@@]2(O)[C@]1(C)[C@H](OC(=O)C=C(C)C(C)C)C[C@@H]1[C@@]3(C)CC[C@H](O)C[C@@]34O[C@H]4C[C@]12O |
| InChI | InChI=1S/C28H42O8/c1-15(2)16(3)11-22(31)35-20-12-19-23(5)8-7-18(30)13-27(23)21(36-27)14-26(19,33)28(34)10-9-25(32,17(4)29)24(20,28)6/h11,15,18-21,30,32-34H,7-10,12-14H2,1-6H3/t18-,19+,20+,21-,23+,24+,25+,26-,27-,28+/m0/s1 |
| InChIKey | KCFLJQSLAOHGBM-ZSZOAWBCSA-N |
| XLogP | 2.20 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|