C20H28O5 — CID 162971408
[(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] (2S)-2-methylbutanoate (PubChem CID 162971408) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] (2S)-2-methylbutanoate.
| Compound Name | [(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 162971408 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] (2S)-2-methylbutanoate |
| SMILES | C=C1CCC=C(C)[C@@]2(O)[C@H](OC(=O)[C@@H](C)CC)[C@@H]3[C@@H](OC(=O)[C@@H]3C)[C@H]12 |
| InChI | InChI=1S/C20H28O5/c1-6-10(2)18(21)25-17-14-13(5)19(22)24-16(14)15-11(3)8-7-9-12(4)20(15,17)23/h9-10,13-17,23H,3,6-8H2,1-2,4-5H3/t10-,13+,14-,15-,16+,17+,20-/m0/s1 |
| InChIKey | WGWCVNUPNYGXFP-OQMAZPNUSA-N |
| XLogP | 2.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|