C15H26O3 — CID 162975091
(1S,3aS,4R,8aR)-4-(hydroxymethyl)-1-methyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol (PubChem CID 162975091) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,3aS,4R,8aR)-4-(hydroxymethyl)-1-methyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol.
| Compound Name | (1S,3aS,4R,8aR)-4-(hydroxymethyl)-1-methyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol |
|---|---|
| PubChem CID | 162975091 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,3aS,4R,8aR)-4-(hydroxymethyl)-1-methyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol |
| SMILES | CC(C)C1=C[C@@H]2[C@H](CC[C@]2(C)O)[C@@](O)(CO)CC1 |
| InChI | InChI=1S/C15H26O3/c1-10(2)11-4-7-15(18,9-16)12-5-6-14(3,17)13(12)8-11/h8,10,12-13,16-18H,4-7,9H2,1-3H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | IBEULDMGWROYNC-XGUBFFRZSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|