C14H22O3 — CID 78210154
1-[(3R,3aR,8S,8aS)-3,8-dihydroxy-3,8-dimethyl-1,2,3a,6,7,8a-hexahydroazulen-5-yl]ethanone (PubChem CID 78210154) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(3R,3aR,8S,8aS)-3,8-dihydroxy-3,8-dimethyl-1,2,3a,6,7,8a-hexahydroazulen-5-yl]ethanone.
| Compound Name | 1-[(3R,3aR,8S,8aS)-3,8-dihydroxy-3,8-dimethyl-1,2,3a,6,7,8a-hexahydroazulen-5-yl]ethanone |
|---|---|
| PubChem CID | 78210154 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-[(3R,3aR,8S,8aS)-3,8-dihydroxy-3,8-dimethyl-1,2,3a,6,7,8a-hexahydroazulen-5-yl]ethanone |
| SMILES | CC(=O)C1=C[C@@H]2[C@H](CC[C@@]2(C)O)[C@@](C)(O)CC1 |
| InChI | InChI=1S/C14H22O3/c1-9(15)10-4-6-13(2,16)11-5-7-14(3,17)12(11)8-10/h8,11-12,16-17H,4-7H2,1-3H3/t11-,12+,13-,14+/m0/s1 |
| InChIKey | ZDCYOFAIOZRPAU-RFQIPJPRSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |