C25H38O7 — CID 162977355
5,9-dimethyl-14-methylidene-15-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 162977355) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is 5,9-dimethyl-14-methylidene-15-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | 5,9-dimethyl-14-methylidene-15-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 162977355 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 5,9-dimethyl-14-methylidene-15-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C=C1C2CCC3C4(C)CCCC(C)(C(=O)O)C4CCC3(C2)C1OC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C25H38O7/c1-13-14-5-6-17-23(2)8-4-9-24(3,22(29)30)16(23)7-10-25(17,11-14)20(13)32-21-19(28)18(27)15(26)12-31-21/h14-21,26-28H,1,4-12H2,2-3H3,(H,29,30) |
| InChIKey | LVDQILCTOJRNNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|