C17H24O2 — CID 162978007
(3R,3aS,6aS,9aS,9bS)-3,6a,9a-trimethyl-6,9-dimethylidene-3a,4,5,7,8,9b-hexahydro-3H-azuleno[4,5-b]furan-2-one (PubChem CID 162978007) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (3R,3aS,6aS,9aS,9bS)-3,6a,9a-trimethyl-6,9-dimethylidene-3a,4,5,7,8,9b-hexahydro-3H-azuleno[4,5-b]furan-2-one.
| Compound Name | (3R,3aS,6aS,9aS,9bS)-3,6a,9a-trimethyl-6,9-dimethylidene-3a,4,5,7,8,9b-hexahydro-3H-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 162978007 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (3R,3aS,6aS,9aS,9bS)-3,6a,9a-trimethyl-6,9-dimethylidene-3a,4,5,7,8,9b-hexahydro-3H-azuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2[C@@H](C)C(=O)O[C@@H]2[C@@]2(C)C(=C)CC[C@@]12C |
| InChI | InChI=1S/C17H24O2/c1-10-6-7-13-12(3)15(18)19-14(13)17(5)11(2)8-9-16(10,17)4/h12-14H,1-2,6-9H2,3-5H3/t12-,13+,14+,16+,17-/m1/s1 |
| InChIKey | FFDIYXPONXMIJM-UAHISNFZSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|