C28H44O4 — CID 162978519
5-(5,6-dimethylhept-3-en-2-yl)-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-ene-5,13-diol (PubChem CID 162978519) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is 5-(5,6-dimethylhept-3-en-2-yl)-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-ene-5,13-diol.
| Compound Name | 5-(5,6-dimethylhept-3-en-2-yl)-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-ene-5,13-diol |
|---|---|
| PubChem CID | 162978519 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 5-(5,6-dimethylhept-3-en-2-yl)-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-ene-5,13-diol |
| SMILES | CC(C)C(C)C=CC(C)C1(O)CCC2C34C=CC5(CC(O)CCC5(C)C3CCC21C)OO4 |
| InChI | InChI=1S/C28H44O4/c1-18(2)19(3)7-8-20(4)28(30)14-11-23-25(28,6)13-10-22-24(5)12-9-21(29)17-26(24)15-16-27(22,23)32-31-26/h7-8,15-16,18-23,29-30H,9-14,17H2,1-6H3 |
| InChIKey | LXIJTUMNXIROPP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|