C28H44O7 — CID 71661217
(2R,9S,12R,13R)-6-(1,3-dihydroxy-2,3-dimethylbutyl)-7,9,13-trimethyl-5,19,20-trioxahexacyclo[16.2.2.01,12.02,9.04,8.013,18]docos-21-ene-7,16-diol (PubChem CID 71661217) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is (2R,9S,12R,13R)-6-(1,3-dihydroxy-2,3-dimethylbutyl)-7,9,13-trimethyl-5,19,20-trioxahexacyclo[16.2.2.01,12.02,9.04,8.013,18]docos-21-ene-7,16-diol.
| Compound Name | (2R,9S,12R,13R)-6-(1,3-dihydroxy-2,3-dimethylbutyl)-7,9,13-trimethyl-5,19,20-trioxahexacyclo[16.2.2.01,12.02,9.04,8.013,18]docos-21-ene-7,16-diol |
|---|---|
| PubChem CID | 71661217 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | (2R,9S,12R,13R)-6-(1,3-dihydroxy-2,3-dimethylbutyl)-7,9,13-trimethyl-5,19,20-trioxahexacyclo[16.2.2.01,12.02,9.04,8.013,18]docos-21-ene-7,16-diol |
| SMILES | CC(C(O)C1OC2C[C@H]3C45C=CC6(CC(O)CC[C@]6(C)[C@H]4CC[C@]3(C)C2C1(C)O)OO5)C(C)(C)O |
| InChI | InChI=1S/C28H44O7/c1-15(23(2,3)31)20(30)22-26(6,32)21-17(33-22)13-19-24(21,4)9-8-18-25(5)10-7-16(29)14-27(25)11-12-28(18,19)35-34-27/h11-12,15-22,29-32H,7-10,13-14H2,1-6H3/t15?,16?,17?,18-,19-,20?,21?,22?,24+,25-,26?,27?,28?/m1/s1 |
| InChIKey | HSENTSRDHIZQCA-IYBZTIBRSA-N |
| XLogP | 2.89 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|