C24H22O9 — CID 162980606
7-hydroxy-10-phenyl-8-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-2-one (PubChem CID 162980606) has the molecular formula C24H22O9 and a molecular weight of 454.43 g/mol. Its IUPAC name is 7-hydroxy-10-phenyl-8-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-2-one.
| Compound Name | 7-hydroxy-10-phenyl-8-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-2-one |
|---|---|
| PubChem CID | 162980606 |
| Molecular Formula | C24H22O9 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 7-hydroxy-10-phenyl-8-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-2-one |
| SMILES | O=C1OCc2cc(O)c(O[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)c3c(-c4ccccc4)ccc1c23 |
| InChI | InChI=1S/C24H22O9/c25-9-16-19(27)20(28)21(29)24(32-16)33-22-15(26)8-12-10-31-23(30)14-7-6-13(18(22)17(12)14)11-4-2-1-3-5-11/h1-8,16,19-21,24-29H,9-10H2/t16-,19-,20+,21-,24+/m0/s1 |
| InChIKey | PGDMYGHCJPKBBF-RRJPFGDRSA-N |
| XLogP | 1.06 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |