C27H24N2O11 — CID 11103619
[(2R,3S,4S,5R,6S)-6-(2,5-dihydroxy-6-oxo-9-phenylphenalen-1-yl)oxy-3,4,5-trihydroxyoxan-2-yl]methyl N-carbamoylcarbamate (PubChem CID 11103619) has the molecular formula C27H24N2O11 and a molecular weight of 552.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(2,5-dihydroxy-6-oxo-9-phenylphenalen-1-yl)oxy-3,4,5-trihydroxyoxan-2-yl]methyl N-carbamoylcarbamate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(2,5-dihydroxy-6-oxo-9-phenylphenalen-1-yl)oxy-3,4,5-trihydroxyoxan-2-yl]methyl N-carbamoylcarbamate |
|---|---|
| PubChem CID | 11103619 |
| Molecular Formula | C27H24N2O11 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(2,5-dihydroxy-6-oxo-9-phenylphenalen-1-yl)oxy-3,4,5-trihydroxyoxan-2-yl]methyl N-carbamoylcarbamate |
| SMILES | NC(=O)NC(=O)OC[C@H]1O[C@@H](Oc2c(O)cc3c4c(ccc(-c5ccccc5)c24)C(=O)C(O)=C3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H24N2O11/c28-26(36)29-27(37)38-10-17-21(33)22(34)23(35)25(39-17)40-24-16(31)9-12-8-15(30)20(32)14-7-6-13(19(24)18(12)14)11-4-2-1-3-5-11/h1-9,17,21-23,25,30-31,33-35H,10H2,(H3,28,29,36,37)/t17-,21-,22+,23-,25+/m1/s1 |
| InChIKey | UAZMCQYNPUKNOV-ZJHKXHAFSA-N |
| XLogP | 1.30 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |