C15H25NO5 — CID 162981409
[(4S,8S)-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate (PubChem CID 162981409) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(4S,8S)-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate.
| Compound Name | [(4S,8S)-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 162981409 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [(4S,8S)-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
| SMILES | CC(C)[C@@](O)(C(=O)OCC1=CC[N@@+]2([O-])CCC[C@@H]12)[C@H](C)O |
| InChI | InChI=1S/C15H25NO5/c1-10(2)15(19,11(3)17)14(18)21-9-12-6-8-16(20)7-4-5-13(12)16/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3/t11-,13-,15-,16-/m0/s1 |
| InChIKey | ZKRKVSLSTMOPAL-MZGVZZPPSA-N |
| XLogP | 0.71 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|