C20H27NO5 — CID 162981820
(1R,4S,8R,18R)-8-hydroxy-8-methyl-7-methylidene-4-[(Z)-prop-1-enyl]-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-12-ene-3,9-dione (PubChem CID 162981820) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1R,4S,8R,18R)-8-hydroxy-8-methyl-7-methylidene-4-[(Z)-prop-1-enyl]-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-12-ene-3,9-dione.
| Compound Name | (1R,4S,8R,18R)-8-hydroxy-8-methyl-7-methylidene-4-[(Z)-prop-1-enyl]-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-12-ene-3,9-dione |
|---|---|
| PubChem CID | 162981820 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (1R,4S,8R,18R)-8-hydroxy-8-methyl-7-methylidene-4-[(Z)-prop-1-enyl]-2,10-dioxa-15-azatricyclo[10.5.1.015,18]octadec-12-ene-3,9-dione |
| SMILES | C=C1CC[C@@H](/C=C\C)C(=O)O[C@@H]2CCN3CC=C(COC(=O)[C@]1(C)O)[C@H]23 |
| InChI | InChI=1S/C20H27NO5/c1-4-5-14-7-6-13(2)20(3,24)19(23)25-12-15-8-10-21-11-9-16(17(15)21)26-18(14)22/h4-5,8,14,16-17,24H,2,6-7,9-12H2,1,3H3/b5-4-/t14-,16-,17-,20-/m1/s1 |
| InChIKey | RUQAEVJQCWAAPZ-LKTAZKGJSA-N |
| XLogP | 1.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|