C22H22O10 — CID 162981876
5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one (PubChem CID 162981876) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one |
|---|---|
| PubChem CID | 162981876 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one |
| SMILES | O=c1c(O[C@@H]2C[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C22H22O10/c23-8-10-5-15(18(28)20(30)17(10)27)32-22-19(29)16-13(26)6-12(25)7-14(16)31-21(22)9-1-3-11(24)4-2-9/h1-4,6-7,10,15,17-18,20,23-28,30H,5,8H2/t10-,15-,17-,18+,20+/m1/s1 |
| InChIKey | GFDAZMDWJRXJFT-DGDUMVRYSA-N |
| XLogP | 0.42 |
| TPSA | 181.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |