C22H20O12 — CID 164938252
(1S,2R,3S,4R,5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-2,3,4-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 164938252) has the molecular formula C22H20O12 and a molecular weight of 476.39 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-2,3,4-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,2R,3S,4R,5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-2,3,4-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164938252 |
| Molecular Formula | C22H20O12 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (1S,2R,3S,4R,5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-2,3,4-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H20O12/c23-8-4-12(26)15-13(5-8)33-20(7-1-2-10(24)11(25)3-7)21(18(15)29)34-14-6-9(22(31)32)16(27)19(30)17(14)28/h1-5,9,14,16-17,19,23-28,30H,6H2,(H,31,32)/t9-,14+,16+,17-,19-/m0/s1 |
| InChIKey | OJZXMKUZPIZIRS-VMNHMXMBSA-N |
| XLogP | 0.22 |
| TPSA | 218.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|