C21H20O10 — CID 123924627
3-(3,4-dihydroxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 123924627) has the molecular formula C21H20O10 and a molecular weight of 432.38 g/mol. Its IUPAC name is 3-(3,4-dihydroxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 3-(3,4-dihydroxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 123924627 |
| Molecular Formula | C21H20O10 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 3-(3,4-dihydroxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | CC1CC(O)C(O)C(Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)O1 |
| InChI | InChI=1S/C21H20O10/c1-8-4-14(26)17(27)21(29-8)31-20-18(28)16-13(25)6-10(22)7-15(16)30-19(20)9-2-3-11(23)12(24)5-9/h2-3,5-8,14,17,21-27H,4H2,1H3 |
| InChIKey | RTFMBAINBOZUQG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|