C22H22O11 — CID 162955500
3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 162955500) has the molecular formula C22H22O11 and a molecular weight of 462.41 g/mol. Its IUPAC name is 3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 162955500 |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | COC1C(C)OC(Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C1O |
| InChI | InChI=1S/C22H22O11/c1-8-19(30-2)17(28)18(29)22(31-8)33-21-16(27)15-13(26)6-10(23)7-14(15)32-20(21)9-3-4-11(24)12(25)5-9/h3-8,17-19,22-26,28-29H,1-2H3 |
| InChIKey | LXABZSKCHVZYGU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|