C25H24O13 — CID 71663775
[(2S,3R,4R,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-2-methyloxan-3-yl] acetate (PubChem CID 71663775) has the molecular formula C25H24O13 and a molecular weight of 532.45 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 71663775 |
| Molecular Formula | C25H24O13 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H](OC(C)=O)[C@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)O[C@H]1C |
| InChI | InChI=1S/C25H24O13/c1-9-21(35-10(2)26)20(33)24(36-11(3)27)25(34-9)38-23-19(32)18-16(31)7-13(28)8-17(18)37-22(23)12-4-5-14(29)15(30)6-12/h4-9,20-21,24-25,28-31,33H,1-3H3/t9-,20+,21-,24+,25-/m0/s1 |
| InChIKey | VOYVPNFACRTCKN-KGNQAMIBSA-N |
| XLogP | 1.63 |
| TPSA | 202.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|