C22H20O12 — CID 102047222
[(2R,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 102047222) has the molecular formula C22H20O12 and a molecular weight of 476.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 102047222 |
| Molecular Formula | C22H20O12 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [(2R,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C22H20O12/c1-8(24)31-21-17(29)15(7-23)33-22(21)34-20-18(30)16-13(28)5-10(25)6-14(16)32-19(20)9-2-3-11(26)12(27)4-9/h2-6,15,17,21-23,25-29H,7H2,1H3/t15-,17-,21+,22-/m1/s1 |
| InChIKey | AYRFSQCHVFOISZ-NUUNWFIMSA-N |
| XLogP | 0.67 |
| TPSA | 196.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|