C23H22O13 — CID 162967860
[6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 162967860) has the molecular formula C23H22O13 and a molecular weight of 506.42 g/mol. Its IUPAC name is [6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 162967860 |
| Molecular Formula | C23H22O13 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(CO)OC(Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C1O |
| InChI | InChI=1S/C23H22O13/c1-8(25)33-21-15(7-24)35-23(19(32)18(21)31)36-22-17(30)16-13(29)5-10(26)6-14(16)34-20(22)9-2-3-11(27)12(28)4-9/h2-6,15,18-19,21,23-24,26-29,31-32H,7H2,1H3 |
| InChIKey | LLSAAPRUQVSWCH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 216.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|