C23H20O14 — CID 162856004
(2S,3S,4S,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid (PubChem CID 162856004) has the molecular formula C23H20O14 and a molecular weight of 520.40 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162856004 |
| Molecular Formula | C23H20O14 |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (2S,3S,4S,5R,6S)-5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H20O14/c1-7(24)34-21-17(31)16(30)20(22(32)33)37-23(21)36-19-15(29)14-12(28)5-9(25)6-13(14)35-18(19)8-2-3-10(26)11(27)4-8/h2-6,16-17,20-21,23,25-28,30-31H,1H3,(H,32,33)/t16-,17-,20-,21+,23+/m0/s1 |
| InChIKey | IRLKNLPAYWYZDV-PSOAEZCFSA-N |
| XLogP | 0.12 |
| TPSA | 233.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|