C31H52O — CID 162982424
(1R,2R,5S,7S,10R,11R,14R,16S)-2,5,7,10,15,15-hexamethyl-7-(5-methylhex-4-enyl)-19-oxapentacyclo[14.2.1.01,14.02,11.05,10]nonadecane (PubChem CID 162982424) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is (1R,2R,5S,7S,10R,11R,14R,16S)-2,5,7,10,15,15-hexamethyl-7-(5-methylhex-4-enyl)-19-oxapentacyclo[14.2.1.01,14.02,11.05,10]nonadecane.
| Compound Name | (1R,2R,5S,7S,10R,11R,14R,16S)-2,5,7,10,15,15-hexamethyl-7-(5-methylhex-4-enyl)-19-oxapentacyclo[14.2.1.01,14.02,11.05,10]nonadecane |
|---|---|
| PubChem CID | 162982424 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | (1R,2R,5S,7S,10R,11R,14R,16S)-2,5,7,10,15,15-hexamethyl-7-(5-methylhex-4-enyl)-19-oxapentacyclo[14.2.1.01,14.02,11.05,10]nonadecane |
| SMILES | CC(C)=CCCC[C@@]1(C)CC[C@]2(C)[C@H]3CC[C@@H]4C(C)(C)[C@@H]5CC[C@]4(O5)[C@]3(C)CC[C@@]2(C)C1 |
| InChI | InChI=1S/C31H52O/c1-22(2)11-9-10-15-27(5)17-19-29(7)24-13-12-23-26(3,4)25-14-16-31(23,32-25)30(24,8)20-18-28(29,6)21-27/h11,23-25H,9-10,12-21H2,1-8H3/t23-,24-,25+,27+,28+,29-,30-,31-/m1/s1 |
| InChIKey | VBQVTHCWRYGUOX-UNJSZJMMSA-N |
| XLogP | 9.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|