C30H48O4 — CID 162982497
10-hydroxy-9-(hydroxymethyl)-4,5,9,13-tetramethyl-19-propan-2-yl-23-oxahexacyclo[15.4.2.01,18.04,17.05,14.08,13]tricosan-22-one (PubChem CID 162982497) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is 10-hydroxy-9-(hydroxymethyl)-4,5,9,13-tetramethyl-19-propan-2-yl-23-oxahexacyclo[15.4.2.01,18.04,17.05,14.08,13]tricosan-22-one.
| Compound Name | 10-hydroxy-9-(hydroxymethyl)-4,5,9,13-tetramethyl-19-propan-2-yl-23-oxahexacyclo[15.4.2.01,18.04,17.05,14.08,13]tricosan-22-one |
|---|---|
| PubChem CID | 162982497 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 10-hydroxy-9-(hydroxymethyl)-4,5,9,13-tetramethyl-19-propan-2-yl-23-oxahexacyclo[15.4.2.01,18.04,17.05,14.08,13]tricosan-22-one |
| SMILES | CC(C)C1CCC23CCC4(C)C5(C)CCC6C(C)(CO)C(O)CCC6(C)C5CCC4(OC2=O)C13 |
| InChI | InChI=1S/C30H48O4/c1-18(2)19-7-13-29-16-15-28(6)27(5)12-8-20-25(3,11-10-22(32)26(20,4)17-31)21(27)9-14-30(28,23(19)29)34-24(29)33/h18-23,31-32H,7-17H2,1-6H3 |
| InChIKey | GPKVULCNKOVDOP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |