C34H58O3 — CID 59876713
10-(hydroxymethyl)-6,10,14,15,18,19,19,20,20,21,21-undecamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-9-ol (PubChem CID 59876713) has the molecular formula C34H58O3 and a molecular weight of 514.84 g/mol. Its IUPAC name is 10-(hydroxymethyl)-6,10,14,15,18,19,19,20,20,21,21-undecamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-9-ol.
| Compound Name | 10-(hydroxymethyl)-6,10,14,15,18,19,19,20,20,21,21-undecamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-9-ol |
|---|---|
| PubChem CID | 59876713 |
| Molecular Formula | C34H58O3 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.44 |
| IUPAC Name | 10-(hydroxymethyl)-6,10,14,15,18,19,19,20,20,21,21-undecamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-9-ol |
| SMILES | CC1(CO)C(O)CCC2(C)C1CCC1(C)C2CC2OC23C2CC(C)(C)C(C)(C)C(C)(C)C2(C)CCC13C |
| InChI | InChI=1S/C34H58O3/c1-26(2)19-23-31(9,28(5,6)27(26,3)4)16-17-33(11)32(10)15-12-21-29(7,14-13-24(36)30(21,8)20-35)22(32)18-25-34(23,33)37-25/h21-25,35-36H,12-20H2,1-11H3 |
| InChIKey | ZEXAXWJVPFWQJF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|