C30H48O7 — CID 87892525
(1S,3R,5R,6R,8R,9R,11R,14R,15S,18R,19S,20R,21R,23R)-8,9,19,20-tetrahydroxy-6,10,10,14,15,18,21-heptamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosane-21-carboxylic acid (PubChem CID 87892525) has the molecular formula C30H48O7 and a molecular weight of 520.71 g/mol. Its IUPAC name is (1S,3R,5R,6R,8R,9R,11R,14R,15S,18R,19S,20R,21R,23R)-8,9,19,20-tetrahydroxy-6,10,10,14,15,18,21-heptamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosane-21-carboxylic acid.
| Compound Name | (1S,3R,5R,6R,8R,9R,11R,14R,15S,18R,19S,20R,21R,23R)-8,9,19,20-tetrahydroxy-6,10,10,14,15,18,21-heptamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosane-21-carboxylic acid |
|---|---|
| PubChem CID | 87892525 |
| Molecular Formula | C30H48O7 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | (1S,3R,5R,6R,8R,9R,11R,14R,15S,18R,19S,20R,21R,23R)-8,9,19,20-tetrahydroxy-6,10,10,14,15,18,21-heptamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosane-21-carboxylic acid |
| SMILES | CC1(C)[C@@H](O)[C@H](O)C[C@]2(C)[C@H]3C[C@H]4O[C@]45[C@@H]4C[C@@](C)(C(=O)O)[C@@H](O)[C@@H](O)[C@]4(C)CC[C@@]5(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H48O7/c1-24(2)16-8-9-28(6)17(26(16,4)13-15(31)20(24)32)12-19-30(37-19)18-14-27(5,23(35)36)22(34)21(33)25(18,3)10-11-29(28,30)7/h15-22,31-34H,8-14H2,1-7H3,(H,35,36)/t15-,16+,17-,18-,19-,20+,21-,22+,25-,26+,27-,28-,29+,30-/m1/s1 |
| InChIKey | GWBBAOYJQSJXOZ-ORSKAWBTSA-N |
| XLogP | 3.36 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|