C22H31NO3 — CID 162983526
(1R,2R,4S,5R,8S,10R,12R,13S,14R,16R,17R,19R)-11-ethyl-5-methyl-18-methylidene-9-oxa-11-azaheptacyclo[15.2.1.01,14.02,12.04,13.05,10.08,13]icosane-16,19-diol (PubChem CID 162983526) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (1R,2R,4S,5R,8S,10R,12R,13S,14R,16R,17R,19R)-11-ethyl-5-methyl-18-methylidene-9-oxa-11-azaheptacyclo[15.2.1.01,14.02,12.04,13.05,10.08,13]icosane-16,19-diol.
| Compound Name | (1R,2R,4S,5R,8S,10R,12R,13S,14R,16R,17R,19R)-11-ethyl-5-methyl-18-methylidene-9-oxa-11-azaheptacyclo[15.2.1.01,14.02,12.04,13.05,10.08,13]icosane-16,19-diol |
|---|---|
| PubChem CID | 162983526 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (1R,2R,4S,5R,8S,10R,12R,13S,14R,16R,17R,19R)-11-ethyl-5-methyl-18-methylidene-9-oxa-11-azaheptacyclo[15.2.1.01,14.02,12.04,13.05,10.08,13]icosane-16,19-diol |
| SMILES | C=C1[C@H]2C[C@@]3([C@@H]1O)[C@@H](C[C@H]2O)[C@]12[C@@H]4CC[C@]5(C)[C@H]1C[C@H]3[C@H]2N(CC)[C@@H]5O4 |
| InChI | InChI=1S/C22H31NO3/c1-4-23-17-12-7-14-20(3)6-5-16(26-19(20)23)22(14,17)15-8-13(24)11-9-21(12,15)18(25)10(11)2/h11-19,24-25H,2,4-9H2,1,3H3/t11-,12+,13-,14-,15-,16+,17-,18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | ULFMQUVPNJZNKM-LXLLEUKKSA-N |
| XLogP | 2.16 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|