C19H26O5 — CID 162985420
[(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] 2-methylpropanoate (PubChem CID 162985420) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] 2-methylpropanoate.
| Compound Name | [(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162985420 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(3R,3aS,4R,4aR,9aS,9bR)-4a-hydroxy-3,5-dimethyl-9-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydro-3H-azuleno[1,2-b]furan-4-yl] 2-methylpropanoate |
| SMILES | C=C1CCC=C(C)[C@@]2(O)[C@H](OC(=O)C(C)C)[C@@H]3[C@@H](OC(=O)[C@@H]3C)[C@H]12 |
| InChI | InChI=1S/C19H26O5/c1-9(2)17(20)24-16-13-12(5)18(21)23-15(13)14-10(3)7-6-8-11(4)19(14,16)22/h8-9,12-16,22H,3,6-7H2,1-2,4-5H3/t12-,13+,14+,15-,16-,19+/m1/s1 |
| InChIKey | DAVDCPBTHVRYEI-OMDXXEBNSA-N |
| XLogP | 2.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|