C15H22O4 — CID 162985594
[(1S,3S,5E)-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate (PubChem CID 162985594) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(1S,3S,5E)-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate.
| Compound Name | [(1S,3S,5E)-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate |
|---|---|
| PubChem CID | 162985594 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(1S,3S,5E)-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(=O)C(=O)/C(C)=C/C(C)(C)[C@@H](C)C1 |
| InChI | InChI=1S/C15H22O4/c1-9-8-15(4,5)10(2)6-12(19-11(3)16)7-13(17)14(9)18/h8,10,12H,6-7H2,1-5H3/b9-8+/t10-,12-/m0/s1 |
| InChIKey | FKOLFUVSOBNFGV-BNWGVOOPSA-N |
| XLogP | 2.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|