C20H25FO4 — CID 162986220
2-(4,7a-dimethyl-1,3-dioxo-3a,5,6,7-tetrahydro-2-benzofuran-4-yl)-7-fluoro-6-methylidenebicyclo[3.2.1]octane-1-carbaldehyde (PubChem CID 162986220) has the molecular formula C20H25FO4 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(4,7a-dimethyl-1,3-dioxo-3a,5,6,7-tetrahydro-2-benzofuran-4-yl)-7-fluoro-6-methylidenebicyclo[3.2.1]octane-1-carbaldehyde.
| Compound Name | 2-(4,7a-dimethyl-1,3-dioxo-3a,5,6,7-tetrahydro-2-benzofuran-4-yl)-7-fluoro-6-methylidenebicyclo[3.2.1]octane-1-carbaldehyde |
|---|---|
| PubChem CID | 162986220 |
| Molecular Formula | C20H25FO4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(4,7a-dimethyl-1,3-dioxo-3a,5,6,7-tetrahydro-2-benzofuran-4-yl)-7-fluoro-6-methylidenebicyclo[3.2.1]octane-1-carbaldehyde |
| SMILES | C=C1C2CCC(C3(C)CCCC4(C)C(=O)OC(=O)C43)C(C=O)(C2)C1F |
| InChI | InChI=1S/C20H25FO4/c1-11-12-5-6-13(20(9-12,10-22)15(11)21)18(2)7-4-8-19(3)14(18)16(23)25-17(19)24/h10,12-15H,1,4-9H2,2-3H3 |
| InChIKey | WKCZSMWYYNNWGT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|