C22H31FO5 — CID 162920299
dimethyl 3-(7-fluoro-1-formyl-6-methylidene-2-bicyclo[3.2.1]octanyl)-1,3-dimethylcyclohexane-1,2-dicarboxylate (PubChem CID 162920299) has the molecular formula C22H31FO5 and a molecular weight of 394.48 g/mol. Its IUPAC name is dimethyl 3-(7-fluoro-1-formyl-6-methylidene-2-bicyclo[3.2.1]octanyl)-1,3-dimethylcyclohexane-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(7-fluoro-1-formyl-6-methylidene-2-bicyclo[3.2.1]octanyl)-1,3-dimethylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 162920299 |
| Molecular Formula | C22H31FO5 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | dimethyl 3-(7-fluoro-1-formyl-6-methylidene-2-bicyclo[3.2.1]octanyl)-1,3-dimethylcyclohexane-1,2-dicarboxylate |
| SMILES | C=C1C2CCC(C3(C)CCCC(C)(C(=O)OC)C3C(=O)OC)C(C=O)(C2)C1F |
| InChI | InChI=1S/C22H31FO5/c1-13-14-7-8-15(22(11-14,12-24)17(13)23)20(2)9-6-10-21(3,19(26)28-5)16(20)18(25)27-4/h12,14-17H,1,6-11H2,2-5H3 |
| InChIKey | RUQKYPCRRPPDIF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|