C20H26O6 — CID 163040058
(1R,2S,3S)-3-[(1R,2S,5R)-1-formyl-6-methylidene-4-oxo-2-bicyclo[3.2.1]octanyl]-1,3-dimethylcyclohexane-1,2-dicarboxylic acid (PubChem CID 163040058) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1R,2S,3S)-3-[(1R,2S,5R)-1-formyl-6-methylidene-4-oxo-2-bicyclo[3.2.1]octanyl]-1,3-dimethylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | (1R,2S,3S)-3-[(1R,2S,5R)-1-formyl-6-methylidene-4-oxo-2-bicyclo[3.2.1]octanyl]-1,3-dimethylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 163040058 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1R,2S,3S)-3-[(1R,2S,5R)-1-formyl-6-methylidene-4-oxo-2-bicyclo[3.2.1]octanyl]-1,3-dimethylcyclohexane-1,2-dicarboxylic acid |
| SMILES | C=C1C[C@]2(C=O)C[C@H]1C(=O)C[C@H]2[C@]1(C)CCC[C@@](C)(C(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C20H26O6/c1-11-8-20(10-21)9-12(11)13(22)7-14(20)18(2)5-4-6-19(3,17(25)26)15(18)16(23)24/h10,12,14-15H,1,4-9H2,2-3H3,(H,23,24)(H,25,26)/t12-,14+,15+,18+,19-,20-/m1/s1 |
| InChIKey | LUMBHDRAYRAUHM-JBNFOXMESA-N |
| XLogP | 2.71 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|