C14H25N3O5 — CID 162986749
(2S,3S)-3-[[(2S,3S)-1-(4-aminobutylamino)-3-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid (PubChem CID 162986749) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2S,3S)-3-[[(2S,3S)-1-(4-aminobutylamino)-3-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[[(2S,3S)-1-(4-aminobutylamino)-3-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 162986749 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2S,3S)-3-[[(2S,3S)-1-(4-aminobutylamino)-3-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H]1O[C@@H]1C(=O)O)C(=O)NCCCCN |
| InChI | InChI=1S/C14H25N3O5/c1-3-8(2)9(12(18)16-7-5-4-6-15)17-13(19)10-11(22-10)14(20)21/h8-11H,3-7,15H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | DNBZVRJVJAAKNX-NAKRPEOUSA-N |
| XLogP | -0.78 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|