C12H25N3O3 — CID 107318472
2-(carbamoylamino)-N-(5-hydroxypentyl)-3-methylpentanamide (PubChem CID 107318472) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(5-hydroxypentyl)-3-methylpentanamide.
| Compound Name | 2-(carbamoylamino)-N-(5-hydroxypentyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 107318472 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(carbamoylamino)-N-(5-hydroxypentyl)-3-methylpentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)NCCCCCO |
| InChI | InChI=1S/C12H25N3O3/c1-3-9(2)10(15-12(13)18)11(17)14-7-5-4-6-8-16/h9-10,16H,3-8H2,1-2H3,(H,14,17)(H3,13,15,18) |
| InChIKey | YIYLRYMIKDBTFS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|