C10H16O6 — CID 162987318
6,7-dihydroxy-7-(hydroxymethyl)-5-methoxy-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one (PubChem CID 162987318) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 6,7-dihydroxy-7-(hydroxymethyl)-5-methoxy-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one.
| Compound Name | 6,7-dihydroxy-7-(hydroxymethyl)-5-methoxy-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 162987318 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 6,7-dihydroxy-7-(hydroxymethyl)-5-methoxy-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one |
| SMILES | COC1C2CC(=O)OCC2C(O)(CO)C1O |
| InChI | InChI=1S/C10H16O6/c1-15-8-5-2-7(12)16-3-6(5)10(14,4-11)9(8)13/h5-6,8-9,11,13-14H,2-4H2,1H3 |
| InChIKey | CMJIOWDIGPEACH-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |