C26H32N2O10 — CID 162987918
[(3R)-3-[(1S)-1-[[(2S)-2-[(2R,3R)-3-acetamido-5-oxooxolan-2-yl]-2-acetyloxyacetyl]amino]-3-methylbutyl]-1-oxo-3,4-dihydroisochromen-8-yl] acetate (PubChem CID 162987918) has the molecular formula C26H32N2O10 and a molecular weight of 532.55 g/mol. Its IUPAC name is [(3R)-3-[(1S)-1-[[(2S)-2-[(2R,3R)-3-acetamido-5-oxooxolan-2-yl]-2-acetyloxyacetyl]amino]-3-methylbutyl]-1-oxo-3,4-dihydroisochromen-8-yl] acetate.
| Compound Name | [(3R)-3-[(1S)-1-[[(2S)-2-[(2R,3R)-3-acetamido-5-oxooxolan-2-yl]-2-acetyloxyacetyl]amino]-3-methylbutyl]-1-oxo-3,4-dihydroisochromen-8-yl] acetate |
|---|---|
| PubChem CID | 162987918 |
| Molecular Formula | C26H32N2O10 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | [(3R)-3-[(1S)-1-[[(2S)-2-[(2R,3R)-3-acetamido-5-oxooxolan-2-yl]-2-acetyloxyacetyl]amino]-3-methylbutyl]-1-oxo-3,4-dihydroisochromen-8-yl] acetate |
| SMILES | CC(=O)N[C@@H]1CC(=O)O[C@H]1[C@H](OC(C)=O)C(=O)N[C@@H](CC(C)C)[C@H]1Cc2cccc(OC(C)=O)c2C(=O)O1 |
| InChI | InChI=1S/C26H32N2O10/c1-12(2)9-17(20-10-16-7-6-8-19(35-14(4)30)22(16)26(34)37-20)28-25(33)24(36-15(5)31)23-18(27-13(3)29)11-21(32)38-23/h6-8,12,17-18,20,23-24H,9-11H2,1-5H3,(H,27,29)(H,28,33)/t17-,18+,20+,23+,24-/m0/s1 |
| InChIKey | ALGDHDLZCBVLPT-ANORAJCXSA-N |
| XLogP | 0.98 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|