C14H22O5 — CID 162990775
(3E,6E,9R,10R)-10-hydroxy-4,9-dimethyldodeca-3,6-dienedioic acid (PubChem CID 162990775) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (3E,6E,9R,10R)-10-hydroxy-4,9-dimethyldodeca-3,6-dienedioic acid.
| Compound Name | (3E,6E,9R,10R)-10-hydroxy-4,9-dimethyldodeca-3,6-dienedioic acid |
|---|---|
| PubChem CID | 162990775 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (3E,6E,9R,10R)-10-hydroxy-4,9-dimethyldodeca-3,6-dienedioic acid |
| SMILES | C/C(=C\CC(=O)O)C/C=C/C[C@@H](C)[C@H](O)CC(=O)O |
| InChI | InChI=1S/C14H22O5/c1-10(7-8-13(16)17)5-3-4-6-11(2)12(15)9-14(18)19/h3-4,7,11-12,15H,5-6,8-9H2,1-2H3,(H,16,17)(H,18,19)/b4-3+,10-7+/t11-,12-/m1/s1 |
| InChIKey | IJESKJBEGUUTIB-MGKSWNFVSA-N |
| XLogP | 2.22 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|