C25H38O — CID 162991674
(E,6S)-6-[(1S,2S,3S,7S)-6,14-dimethylidene-3-tricyclo[8.4.1.02,7]pentadec-10-enyl]-2-methylhept-2-en-1-ol (PubChem CID 162991674) has the molecular formula C25H38O and a molecular weight of 354.58 g/mol. Its IUPAC name is (E,6S)-6-[(1S,2S,3S,7S)-6,14-dimethylidene-3-tricyclo[8.4.1.02,7]pentadec-10-enyl]-2-methylhept-2-en-1-ol.
| Compound Name | (E,6S)-6-[(1S,2S,3S,7S)-6,14-dimethylidene-3-tricyclo[8.4.1.02,7]pentadec-10-enyl]-2-methylhept-2-en-1-ol |
|---|---|
| PubChem CID | 162991674 |
| Molecular Formula | C25H38O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (E,6S)-6-[(1S,2S,3S,7S)-6,14-dimethylidene-3-tricyclo[8.4.1.02,7]pentadec-10-enyl]-2-methylhept-2-en-1-ol |
| SMILES | C=C1CC[C@@H]([C@@H](C)CC/C=C(\C)CO)[C@H]2[C@@H]1CCC1=CCCC(=C)[C@H]2C1 |
| InChI | InChI=1S/C25H38O/c1-17(16-26)7-5-8-18(2)22-13-11-20(4)23-14-12-21-10-6-9-19(3)24(15-21)25(22)23/h7,10,18,22-26H,3-6,8-9,11-16H2,1-2H3/b17-7+/t18-,22-,23+,24+,25-/m0/s1 |
| InChIKey | UTURTWRYGLGHFA-GUOXXBHWSA-N |
| XLogP | 6.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|